Urolithin B

Aprili 8, 2021

I-Urolithin B inciphisa ukonakaliswa kweprotein kwaye inciphisa i-hypertrophy yemisipha. I-Urolithin B inqanda umsebenzi we-aromatase, i-enzyme eguqula i-estrogen kunye ne-testosterone.

Ividiyo yeUrolithin B

 

Ulwazi ngemichiza Urolithin B

Igama lemveliso I-Urolithin B powder
Igama leKhemikhali 3-hydroxy-6H-benzo [c] chromen-6-nye

3-hydroxybenzo [c] chromen-6-inye

Uro-B

I-3-Hydroxyurolithin

Inani leCAS 1139-83-9
InChIKey I-WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILE C1=CC=C2C(=C1)C3=C(C=C(C=C3)O)OC2=O
I-Molecular Formula C13H8O3
Isisindo somzimba 212.2 g / mol
IMasaisotopic Mass 212.047344 g / mol
Indawo yokunyibilika 247 ° C
umbala Mhlophe ukuya kumgubo we-beige
Umzimba I-DMSO: i-soluble5mg / mL, icacile (ishushu)
Sitempile yetanki 2-8 ° C
isicelo I-Urolithin B isetyenzisiwe kulwakhiwo lomzimba nakwindawo zokongeza.

isingqiniso

[1] U-Lee G, et al. Iinkqubo ezichasene nokuvuvukala kunye ne-antioxidant ye-urolithin B kwi-microglia esebenzayo. Unyango lwezonyango. 2019 ngoMatshi 1; 55: 50-57. [2]. URodriguez J, okqhubekayo. Urolithin B, umlawuli osanda kuchongwa wesisipha samathambo. J Imisipha yeCachexia Sarcopenia. Ngo-2017 Agasti; 8 (4): 583-597.

[2] Iinkqubo ezichasene nokuvuvukala kunye ne-antioxidant ye-urolithin B kwi-microglia esebenzayo. Lee G, iPark JS, Lee EJ, Ahn JH, Kim HS.

[3] Urolithin B, umlawuli osanda kuchongwa wesisipha samathambo URodriguez J, Pierre N, Naslain D, Bontemps F, Ferreira D, Priem F, Deldicque L, Francaux M.

[4] I-Urolithin B, i-gut microbiota metabolite, ikhusela ngokuchasene ne-myocardial ischemia / reperfusion ukwenzakala nge-p62 / Keap1 / Nrf2 indlela yokubonisa. Zheng D, Liu Z, Zhou Y, Hou N, Yan W, Qin Y, Ye Q, Cheng X, Xiao Q , UBao Y, uLuo J, uWu X.